6-methoxy-9H-carbazole-3-carboxylic acid
Internal ID | 4b0cb098-7e8e-4134-9b8d-4d0f6261acc6 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | 6-methoxy-9H-carbazole-3-carboxylic acid |
SMILES (Canonical) | COC1=CC2=C(C=C1)NC3=C2C=C(C=C3)C(=O)O |
SMILES (Isomeric) | COC1=CC2=C(C=C1)NC3=C2C=C(C=C3)C(=O)O |
InChI | InChI=1S/C14H11NO3/c1-18-9-3-5-13-11(7-9)10-6-8(14(16)17)2-4-12(10)15-13/h2-7,15H,1H3,(H,16,17) |
InChI Key | CFNPTGYSAAZIAE-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C14H11NO3 |
Molecular Weight | 241.24 g/mol |
Exact Mass | 241.07389321 g/mol |
Topological Polar Surface Area (TPSA) | 62.30 Ų |
XlogP | 2.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.60% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.97% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.18% | 90.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.40% | 93.99% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.94% | 96.09% |
CHEMBL2535 | P11166 | Glucose transporter | 90.63% | 98.75% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.88% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.38% | 86.33% |
CHEMBL1907 | P15144 | Aminopeptidase N | 84.53% | 93.31% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 84.31% | 87.67% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 81.54% | 94.08% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 80.37% | 90.20% |
CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 80.26% | 93.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Clausena lansium |
PubChem | 21087559 |
LOTUS | LTS0206630 |
wikiData | Q104956825 |