6-Methoxy-4-methylindeno[2,3-b]pyridin-9-one
| Internal ID | 002a3ad1-6f6d-4246-b706-c6c7fcc9e949 |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | 6-methoxy-4-methylindeno[2,3-b]pyridin-9-one |
| SMILES (Canonical) | CC1=C2C3=C(C=CC(=C3)OC)C(=O)C2=NC=C1 |
| SMILES (Isomeric) | CC1=C2C3=C(C=CC(=C3)OC)C(=O)C2=NC=C1 |
| InChI | InChI=1S/C14H11NO2/c1-8-5-6-15-13-12(8)11-7-9(17-2)3-4-10(11)14(13)16/h3-7H,1-2H3 |
| InChI Key | UMEWJZYFUGSCTJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.078978594 g/mol |
| Topological Polar Surface Area (TPSA) | 39.20 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
![2D Structure of 6-Methoxy-4-methylindeno[2,3-b]pyridin-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/6-methoxy-4-methylindeno23-bpyridin-9-one.jpg "2D Structure of 6-Methoxy-4-methylindeno[2,3-b]pyridin-9-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1907 | P15144 | Aminopeptidase N | 94.98% | 93.31% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.62% | 94.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 93.38% | 96.67% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.75% | 91.49% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.70% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.09% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.61% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.40% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.38% | 96.09% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 90.30% | 96.47% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.17% | 86.33% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 87.67% | 100.00% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 87.46% | 93.65% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 86.74% | 93.18% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.27% | 94.73% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 85.10% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.75% | 90.00% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.75% | 97.53% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.79% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.61% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Guatteria blepharophylla |
| PubChem | 163025765 |
| LOTUS | LTS0195869 |
| wikiData | Q105275527 |