6-methoxy-2,8,8-trimethyl-2,9-dihydro-1H-pyrano[4,3-f]chromene-4,10-dione
| Internal ID | 940f7f8d-258a-442a-a145-186b4b905696 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > 2,2-dimethyl-1-benzopyrans |
| IUPAC Name | 6-methoxy-2,8,8-trimethyl-2,9-dihydro-1H-pyrano[4,3-f]chromene-4,10-dione |
| SMILES (Canonical) | CC1CC2=C3C(=O)CC(OC3=C(C=C2C(=O)O1)OC)(C)C |
| SMILES (Isomeric) | CC1CC2=C3C(=O)CC(OC3=C(C=C2C(=O)O1)OC)(C)C |
| InChI | InChI=1S/C16H18O5/c1-8-5-9-10(15(18)20-8)6-12(19-4)14-13(9)11(17)7-16(2,3)21-14/h6,8H,5,7H2,1-4H3 |
| InChI Key | KWFWITMTZVXDQD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.11542367 g/mol |
| Topological Polar Surface Area (TPSA) | 61.80 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
![2D Structure of 6-methoxy-2,8,8-trimethyl-2,9-dihydro-1H-pyrano[4,3-f]chromene-4,10-dione](https://plantaedb.com/storage/docs/compounds/2023/11/6-methoxy-288-trimethyl-29-dihydro-1h-pyrano43-fchromene-410-dione.jpg "2D Structure of 6-methoxy-2,8,8-trimethyl-2,9-dihydro-1H-pyrano[4,3-f]chromene-4,10-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.76% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.27% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.18% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.77% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.47% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.70% | 85.14% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.41% | 97.14% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.63% | 98.75% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.55% | 96.77% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.02% | 96.21% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.26% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.97% | 94.00% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 85.84% | 97.05% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.50% | 92.94% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.74% | 96.00% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 83.55% | 95.53% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.48% | 99.23% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.32% | 82.38% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 82.28% | 93.31% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 82.17% | 82.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.24% | 95.89% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.69% | 91.07% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.57% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162855467 |
| LOTUS | LTS0235933 |
| wikiData | Q104170652 |