6-Methoxy-[2'',3'':7,8]furanoflavanone
| Internal ID | f08ca9b8-4645-4086-897f-bfa77b5951e8 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Furanoflavonoids and dihydrofuranoflavonoids |
| IUPAC Name | 6-methoxy-2-phenyl-2,3-dihydrofuro[2,3-h]chromen-4-one |
| SMILES (Canonical) | COC1=C2C(=C3C(=C1)C(=O)CC(O3)C4=CC=CC=C4)C=CO2 |
| SMILES (Isomeric) | COC1=C2C(=C3C(=C1)C(=O)CC(O3)C4=CC=CC=C4)C=CO2 |
| InChI | InChI=1S/C18H14O4/c1-20-16-9-13-14(19)10-15(11-5-3-2-4-6-11)22-17(13)12-7-8-21-18(12)16/h2-9,15H,10H2,1H3 |
| InChI Key | UFIKASAICBBABY-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.08920892 g/mol |
| Topological Polar Surface Area (TPSA) | 48.70 Ų |
| XlogP | 3.30 |
| LMPK12140082 |
![2D Structure of 6-Methoxy-[2'',3'':7,8]furanoflavanone](https://plantaedb.com/storage/docs/compounds/2023/11/6-methoxy-2378furanoflavanone.jpg "2D Structure of 6-Methoxy-[2'',3'':7,8]furanoflavanone")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.87% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.39% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.51% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.07% | 85.14% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 92.16% | 94.03% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.62% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.47% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.01% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.17% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.54% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.80% | 94.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.37% | 95.89% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.25% | 96.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.92% | 97.14% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 81.70% | 91.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.82% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Millettia erythrocalyx |
| PubChem | 42607828 |
| LOTUS | LTS0107308 |
| wikiData | Q105271880 |