6-Methoxy-2-[2-(3-methoxyphenyl)ethyl] chromone
| Internal ID | 37b5d03e-9ed3-49f6-9c07-0237efd5544c |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones |
| IUPAC Name | 6-methoxy-2-[2-(3-methoxyphenyl)ethyl]chromen-4-one |
| SMILES (Canonical) | COC1=CC2=C(C=C1)OC(=CC2=O)CCC3=CC(=CC=C3)OC |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)OC(=CC2=O)CCC3=CC(=CC=C3)OC |
| InChI | InChI=1S/C19H18O4/c1-21-14-5-3-4-13(10-14)6-7-16-12-18(20)17-11-15(22-2)8-9-19(17)23-16/h3-5,8-12H,6-7H2,1-2H3 |
| InChI Key | ZPXODGLAGYZOOM-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.12050905 g/mol |
| Topological Polar Surface Area (TPSA) | 44.80 Ų |
| XlogP | 3.70 |
| 6-methoxy-2-[2-(3-methoxyphenyl)ethyl] chromone |
![2D Structure of 6-Methoxy-2-[2-(3-methoxyphenyl)ethyl] chromone](https://plantaedb.com/storage/docs/compounds/2023/11/6-methoxy-2-2-3-methoxyphenylethyl-chromone.jpg "2D Structure of 6-Methoxy-2-[2-(3-methoxyphenyl)ethyl] chromone")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.14% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.21% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.79% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.85% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.76% | 94.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 92.83% | 93.31% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.31% | 86.33% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.56% | 86.92% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.20% | 98.75% |
| CHEMBL240 | Q12809 | HERG | 90.12% | 89.76% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.81% | 93.99% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 88.49% | 92.67% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.14% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.10% | 99.17% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.98% | 92.62% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.91% | 95.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.97% | 95.89% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.03% | 99.18% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.94% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aquilaria sinensis |
| PubChem | 5319468 |
| LOTUS | LTS0024689 |
| wikiData | Q105381295 |