6-Isobutyryl-5,7-dimethoxy-2,2-dimethylbenzopyran
Internal ID | b59acd6b-19ee-4c4e-a706-995693048f71 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > 2,2-dimethyl-1-benzopyrans |
IUPAC Name | 1-(5,7-dimethoxy-2,2-dimethylchromen-6-yl)-2-methylpropan-1-one |
SMILES (Canonical) | CC(C)C(=O)C1=C(C=C2C(=C1OC)C=CC(O2)(C)C)OC |
SMILES (Isomeric) | CC(C)C(=O)C1=C(C=C2C(=C1OC)C=CC(O2)(C)C)OC |
InChI | InChI=1S/C17H22O4/c1-10(2)15(18)14-13(19-5)9-12-11(16(14)20-6)7-8-17(3,4)21-12/h7-10H,1-6H3 |
InChI Key | TXAQIOZLMJJXGS-UHFFFAOYSA-N |
Popularity | 12 references in papers |
Molecular Formula | C17H22O4 |
Molecular Weight | 290.40 g/mol |
Exact Mass | 290.15180918 g/mol |
Topological Polar Surface Area (TPSA) | 44.80 Ų |
XlogP | 3.50 |
6-Isobutyryl-5,7-dimethoxy-2,2-dimethyl-benzopyran |
SCHEMBL3701446 |
CHEMBL4174516 |
1-(5,7-dimethoxy-2,2-dimethylchromen-6-yl)-2-methylpropan-1-one |
1-(5,7-Dimethoxy-2,2-dimethyl-2H-chromen-6-yl)-2-methyl-propan-1-one |
1-(5,7-dimethoxy-2,2-dimethyl-2H-chromen-6-yl)-2-methylpropan-1-one |
1-propanone, 1-(5,7-dimethoxy-2,2-dimethyl-2H-1-benzopyran-6-yl)-2-methyl- |
InChI=1/C17H22O4/c1-10(2)15(18)14-13(19-5)9-12-11(16(14)20-6)7-8-17(3,4)21-12/h7-10H,1-6H |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.24% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.36% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.86% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.97% | 85.14% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.12% | 90.00% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 86.70% | 90.20% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.96% | 91.07% |
CHEMBL2535 | P11166 | Glucose transporter | 85.55% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.49% | 86.33% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.11% | 96.77% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.60% | 92.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.98% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.34% | 94.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.05% | 89.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.47% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.08% | 95.56% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.15% | 97.14% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.25% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hypericum polyanthemum |
PubChem | 637410 |
LOTUS | LTS0158209 |
wikiData | Q105266347 |