6-[hydroxy(phenyl)methyl]-4-oxo-1H-pyridine-3-carboxamide
| Internal ID | dca4396b-af36-449f-a1a6-365c4eec21a0 |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Pyridinecarboxylic acids and derivatives > Pyridinecarboxamides > Nicotinamides |
| IUPAC Name | 6-[hydroxy(phenyl)methyl]-4-oxo-1H-pyridine-3-carboxamide |
| SMILES (Canonical) | C1=CC=C(C=C1)C(C2=CC(=O)C(=CN2)C(=O)N)O |
| SMILES (Isomeric) | C1=CC=C(C=C1)C(C2=CC(=O)C(=CN2)C(=O)N)O |
| InChI | InChI=1S/C13H12N2O3/c14-13(18)9-7-15-10(6-11(9)16)12(17)8-4-2-1-3-5-8/h1-7,12,17H,(H2,14,18)(H,15,16) |
| InChI Key | DIKSXFGBISXWOX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08479225 g/mol |
| Topological Polar Surface Area (TPSA) | 92.40 Ų |
| XlogP | 0.60 |
| There are no found synonyms. |
![2D Structure of 6-[hydroxy(phenyl)methyl]-4-oxo-1H-pyridine-3-carboxamide](https://plantaedb.com/storage/docs/compounds/2023/11/6-hydroxyphenylmethyl-4-oxo-1h-pyridine-3-carboxamide.jpg "2D Structure of 6-[hydroxy(phenyl)methyl]-4-oxo-1H-pyridine-3-carboxamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.74% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.03% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.09% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.00% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.81% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.14% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.12% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.00% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.57% | 86.33% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.39% | 93.03% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 85.24% | 93.81% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.68% | 94.62% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 83.04% | 89.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162944242 |
| LOTUS | LTS0195773 |
| wikiData | Q103818419 |