6-Hydroxy-L-tryptophan
| Internal ID | 7b09330b-62c5-4262-bce6-86925fd56a59 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolyl carboxylic acids and derivatives |
| IUPAC Name | (2S)-2-amino-3-(6-hydroxy-1H-indol-3-yl)propanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-4-7(14)1-2-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16)/t9-/m0/s1 |
| InChI Key | NXANGIZFHQQBCC-VIFPVBQESA-N |
| Popularity | 18 references in papers |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.08479225 g/mol |
| Topological Polar Surface Area (TPSA) | 99.30 Ų |
| XlogP | -1.20 |
| (S)-2-Amino-3-(6-hydroxy-1H-indol-3-yl)propanoic acid |
| 6-HYDROXY-L-TRYPTOPHAN |
| 6-hydroxytryptophan |
| (2S)-2-amino-3-(6-hydroxy-1H-indol-3-yl)propanoic acid |
| Tryptophan, 6-hydroxy- |
| SCHEMBL179963 |
| (S)-2-Amino-3-(6-hydroxy-1H-indol-3-yl)propanoicacid |
| DTXSID60678820 |
| MFCD19105439 |
| CS-W000483 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.23% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.74% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.85% | 94.45% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.17% | 83.82% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 94.07% | 89.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.00% | 98.95% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.52% | 90.20% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.81% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.69% | 95.56% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 88.56% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.50% | 99.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.80% | 96.95% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 85.85% | 94.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.16% | 98.75% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 83.93% | 83.10% |
| CHEMBL3194 | P02766 | Transthyretin | 83.83% | 90.71% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.03% | 91.71% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.02% | 97.21% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 80.67% | 82.86% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 80.24% | 97.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 49867758 |
| LOTUS | LTS0058079 |
| wikiData | Q27466719 |