6-Hydroxy-8,8-dimethyl-2-phenylpyrano[2,3-h]chromen-4-one
| Internal ID | 3dad05a9-3235-4052-9a57-b9e79aa3385b |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Pyranoflavonoids |
| IUPAC Name | 6-hydroxy-8,8-dimethyl-2-phenylpyrano[2,3-h]chromen-4-one |
| SMILES (Canonical) | CC1(C=CC2=C3C(=CC(=C2O1)O)C(=O)C=C(O3)C4=CC=CC=C4)C |
| SMILES (Isomeric) | CC1(C=CC2=C3C(=CC(=C2O1)O)C(=O)C=C(O3)C4=CC=CC=C4)C |
| InChI | InChI=1S/C20H16O4/c1-20(2)9-8-13-18-14(10-16(22)19(13)24-20)15(21)11-17(23-18)12-6-4-3-5-7-12/h3-11,22H,1-2H3 |
| InChI Key | ZEKRJDMRETVRHI-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10485899 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
![2D Structure of 6-Hydroxy-8,8-dimethyl-2-phenylpyrano[2,3-h]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/6-hydroxy-88-dimethyl-2-phenylpyrano23-hchromen-4-one.jpg "2D Structure of 6-Hydroxy-8,8-dimethyl-2-phenylpyrano[2,3-h]chromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.42% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.98% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.58% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.09% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.85% | 99.15% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.98% | 91.49% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.93% | 85.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.39% | 99.23% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.04% | 93.99% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.81% | 90.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.07% | 94.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.82% | 94.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.00% | 86.33% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 83.39% | 89.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.52% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Millettia pulchra |
| PubChem | 38364007 |
| LOTUS | LTS0081807 |
| wikiData | Q105373381 |