(6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl) (2S)-3-hydroxy-2-phenylpropanoate
| Internal ID | 6e2522b1-1399-4093-9d01-b852d4f255ea |
| Taxonomy | Alkaloids and derivatives > Tropane alkaloids |
| IUPAC Name | (6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl) (2S)-3-hydroxy-2-phenylpropanoate |
| SMILES (Canonical) | CN1C2CC(CC1C(C2)O)OC(=O)C(CO)C3=CC=CC=C3 |
| SMILES (Isomeric) | CN1C2CC(CC1C(C2)O)OC(=O)[C@H](CO)C3=CC=CC=C3 |
| InChI | InChI=1S/C17H23NO4/c1-18-12-7-13(9-15(18)16(20)8-12)22-17(21)14(10-19)11-5-3-2-4-6-11/h2-6,12-16,19-20H,7-10H2,1H3/t12?,13?,14-,15?,16?/m1/s1 |
| InChI Key | WTQYWNWRJNXDEG-GMOYYMRRSA-N |
| Popularity | 390 references in papers |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.16270821 g/mol |
| Topological Polar Surface Area (TPSA) | 70.00 Ų |
| XlogP | 0.90 |
| 6-beta-hydroxyhyoscyamine |
| 55869-99-3 |
![2D Structure of (6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl) (2S)-3-hydroxy-2-phenylpropanoate](https://plantaedb.com/storage/docs/compounds/2023/11/6-hydroxy-8-methyl-8-azabicyclo321octan-3-yl-2s-3-hydroxy-2-phenylpropanoate.jpg "2D Structure of (6-hydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl) (2S)-3-hydroxy-2-phenylpropanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.97% | 96.09% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 98.62% | 94.62% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 96.97% | 94.08% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.85% | 98.95% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 95.05% | 94.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.27% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.15% | 86.33% |
| CHEMBL5028 | O14672 | ADAM10 | 85.57% | 97.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.34% | 91.19% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.18% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.62% | 97.09% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.42% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Atropa belladonna |
| Cyphanthera myosotidea |
| Cyphanthera tasmanica |
| Datura innoxia |
| Duboisia myoporoides |
| Hyoscyamus albus |
| PubChem | 129628892 |
| LOTUS | LTS0130037 |
| wikiData | Q104252977 |