6-hydroxy-8-(3-hydroxy-3-methylbut-1-enyl)-2,2-dimethyl-3H-chromen-4-one
| Internal ID | 774f11f6-9a29-4a85-bc72-306ae4c99023 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > 2,2-dimethyl-1-benzopyrans |
| IUPAC Name | 6-hydroxy-8-(3-hydroxy-3-methylbut-1-enyl)-2,2-dimethyl-3H-chromen-4-one |
| SMILES (Canonical) | CC1(CC(=O)C2=CC(=CC(=C2O1)C=CC(C)(C)O)O)C |
| SMILES (Isomeric) | CC1(CC(=O)C2=CC(=CC(=C2O1)C=CC(C)(C)O)O)C |
| InChI | InChI=1S/C16H20O4/c1-15(2,19)6-5-10-7-11(17)8-12-13(18)9-16(3,4)20-14(10)12/h5-8,17,19H,9H2,1-4H3 |
| InChI Key | QEWXBEOAUQSKSC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.75% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.24% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.32% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.21% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.17% | 89.00% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 88.33% | 90.93% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.80% | 94.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.66% | 94.73% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.88% | 90.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.26% | 96.09% |
| CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 84.15% | 98.00% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.13% | 85.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.77% | 99.23% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 80.69% | 80.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ophryosporus lorentzii |
| PubChem | 162977504 |
| LOTUS | LTS0092158 |
| wikiData | Q105219422 |