6-Hydroxy-7,8-dimethoxy-4-methylbenzo[g]quinoline-5,10-dione
| Internal ID | a176c013-4fe5-4b8d-9a5a-323e9c6e6977 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Benzoquinolines |
| IUPAC Name | 6-hydroxy-7,8-dimethoxy-4-methylbenzo[g]quinoline-5,10-dione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H13NO5/c1-7-4-5-17-12-10(7)14(19)11-8(13(12)18)6-9(21-2)16(22-3)15(11)20/h4-6,20H,1-3H3 |
| InChI Key | RQSMBJYONAIACA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.07937252 g/mol |
| Topological Polar Surface Area (TPSA) | 85.70 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of 6-Hydroxy-7,8-dimethoxy-4-methylbenzo[g]quinoline-5,10-dione](https://plantaedb.com/storage/docs/compounds/2023/11/6-hydroxy-78-dimethoxy-4-methylbenzogquinoline-510-dione.jpg "2D Structure of 6-Hydroxy-7,8-dimethoxy-4-methylbenzo[g]quinoline-5,10-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.49% | 94.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.29% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.23% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.13% | 86.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.98% | 99.15% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 90.44% | 96.67% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 90.37% | 96.47% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.98% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.94% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.86% | 96.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.27% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.13% | 91.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.70% | 99.23% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 85.08% | 94.42% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.76% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.10% | 94.73% |
| CHEMBL5014 | O43353 | Serine/threonine-protein kinase RIPK2 | 83.66% | 86.79% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.48% | 99.17% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.19% | 100.00% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.56% | 96.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.54% | 93.18% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.10% | 93.65% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.96% | 90.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.04% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Porcelia macrocarpa |
| PubChem | 10827989 |
| LOTUS | LTS0056075 |
| wikiData | Q105243546 |