6-Hydroxy-7-methoxy-4-methyl-2H-chromen-2-one
| Internal ID | 172e8e3c-ba9a-4b10-a8e6-5cd9f46d078a |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Hydroxycoumarins |
| IUPAC Name | 6-hydroxy-7-methoxy-4-methylchromen-2-one |
| SMILES (Canonical) | CC1=CC(=O)OC2=CC(=C(C=C12)O)OC |
| SMILES (Isomeric) | CC1=CC(=O)OC2=CC(=C(C=C12)O)OC |
| InChI | InChI=1S/C11H10O4/c1-6-3-11(13)15-9-5-10(14-2)8(12)4-7(6)9/h3-5,12H,1-2H3 |
| InChI Key | XICLZVQOVIQOBV-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.05790880 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 1.40 |
| 4-Methyl-7-methoxy-6-hydroxycoumarin |
| TJB10ZFF3K |
| UNII-TJB10ZFF3K |
| 6-Hydroxy-7-methoxy-4-methyl-2H-1-benzopyran-2-one |
| NSC 43567 |
| NSC-43567 |
| DTXSID00212868 |
| 6-hydroxy-7-methoxy-4-methylcoumarin |
| RefChem:104744 |
| DTXCID30135359 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.62% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.10% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.46% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.36% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.03% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.93% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.76% | 86.33% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 85.57% | 98.11% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.08% | 93.65% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.25% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.54% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.35% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.13% | 98.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.99% | 85.14% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.92% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ammi majus |
| PubChem | 238946 |
| LOTUS | LTS0062782 |
| wikiData | Q83088085 |