6-Hydroxy-5,7-dimethoxy-3-[(4-methoxyphenyl)methyl]-2,3-dihydrochromen-4-one
Internal ID | ba891acd-ac89-4add-b72e-7a4e7407dd5d |
Taxonomy | Phenylpropanoids and polyketides > Homoisoflavonoids > Homoisoflavans > Homoisoflavanones |
IUPAC Name | 6-hydroxy-5,7-dimethoxy-3-[(4-methoxyphenyl)methyl]-2,3-dihydrochromen-4-one |
SMILES (Canonical) | COC1=CC=C(C=C1)CC2COC3=CC(=C(C(=C3C2=O)OC)O)OC |
SMILES (Isomeric) | COC1=CC=C(C=C1)CC2COC3=CC(=C(C(=C3C2=O)OC)O)OC |
InChI | InChI=1S/C19H20O6/c1-22-13-6-4-11(5-7-13)8-12-10-25-14-9-15(23-2)18(21)19(24-3)16(14)17(12)20/h4-7,9,12,21H,8,10H2,1-3H3 |
InChI Key | FUTUWACAESFWSM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H20O6 |
Molecular Weight | 344.40 g/mol |
Exact Mass | 344.12598835 g/mol |
Topological Polar Surface Area (TPSA) | 74.20 Ų |
XlogP | 2.90 |
There are no found synonyms. |
![2D Structure of 6-Hydroxy-5,7-dimethoxy-3-[(4-methoxyphenyl)methyl]-2,3-dihydrochromen-4-one 2D Structure of 6-Hydroxy-5,7-dimethoxy-3-[(4-methoxyphenyl)methyl]-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/6-hydroxy-57-dimethoxy-3-4-methoxyphenylmethyl-23-dihydrochromen-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.32% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.28% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.24% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.61% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.54% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.31% | 92.62% |
CHEMBL2581 | P07339 | Cathepsin D | 92.18% | 98.95% |
CHEMBL4208 | P20618 | Proteasome component C5 | 90.90% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.78% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.03% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.55% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.56% | 99.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.90% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.13% | 95.50% |
CHEMBL2535 | P11166 | Glucose transporter | 84.05% | 98.75% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.70% | 85.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.58% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.79% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Schizocarphus nervosus |
PubChem | 15484399 |
LOTUS | LTS0213937 |
wikiData | Q105001991 |