6-hydroxy-5-(3-methylbut-2-enyl)-9H-carbazole-3-carbaldehyde
Internal ID | 8e02d1c1-cbee-446c-8128-3dd5d917ae66 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | 6-hydroxy-5-(3-methylbut-2-enyl)-9H-carbazole-3-carbaldehyde |
SMILES (Canonical) | CC(=CCC1=C(C=CC2=C1C3=C(N2)C=CC(=C3)C=O)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C=CC2=C1C3=C(N2)C=CC(=C3)C=O)O)C |
InChI | InChI=1S/C18H17NO2/c1-11(2)3-5-13-17(21)8-7-16-18(13)14-9-12(10-20)4-6-15(14)19-16/h3-4,6-10,19,21H,5H2,1-2H3 |
InChI Key | GCNGRDPCOLMSIC-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C18H17NO2 |
Molecular Weight | 279.30 g/mol |
Exact Mass | 279.125928785 g/mol |
Topological Polar Surface Area (TPSA) | 53.10 Ų |
XlogP | 4.40 |
CHEMBL2260659 |
6-hydroxy-5-(3-methylbut-2-enyl)-9H-carbazole-3-carbaldehyde |
9H-Carbazole-3-carboxaldehyde, 6-hydroxy-5-(3-methyl-2-butenyl)- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.51% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.02% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.78% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.97% | 95.56% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 94.74% | 98.11% |
CHEMBL2581 | P07339 | Cathepsin D | 91.97% | 98.95% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 91.42% | 91.71% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 90.38% | 98.59% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.90% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.04% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.78% | 89.00% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 84.17% | 83.10% |
CHEMBL2535 | P11166 | Glucose transporter | 83.81% | 98.75% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.06% | 94.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.16% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Micromelum hirsutum |
Nephelium lappaceum |
PubChem | 5278450 |
LOTUS | LTS0048521 |
wikiData | Q104919770 |