6-Hydroxy-4,5-dimethoxynaphthalene-2-carbaldehyde
| Internal ID | dd44b86d-0c40-4e9d-840f-dbd5bc389e18 |
| Taxonomy | Benzenoids > Naphthalenes > Naphthols and derivatives |
| IUPAC Name | 6-hydroxy-4,5-dimethoxynaphthalene-2-carbaldehyde |
| SMILES (Canonical) | COC1=C2C(=CC(=C1)C=O)C=CC(=C2OC)O |
| SMILES (Isomeric) | COC1=C2C(=CC(=C1)C=O)C=CC(=C2OC)O |
| InChI | InChI=1S/C13H12O4/c1-16-11-6-8(7-14)5-9-3-4-10(15)13(17-2)12(9)11/h3-7,15H,1-2H3 |
| InChI Key | KOCSGSHVBGSKOI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07355886 g/mol |
| Topological Polar Surface Area (TPSA) | 55.80 Ų |
| XlogP | 2.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 97.03% | 98.11% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.06% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.81% | 95.56% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 93.48% | 80.78% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.58% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.63% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.11% | 90.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.25% | 96.00% |
| CHEMBL3194 | P02766 | Transthyretin | 86.89% | 90.71% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.31% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.33% | 98.75% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.22% | 89.62% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.19% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.93% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.11% | 94.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 82.72% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Diospyros ebenum |
| Diospyros paniculata |
| PubChem | 162968220 |
| LOTUS | LTS0216470 |
| wikiData | Q105143755 |