6'-Hydroxy-4,4'-dimethoxychalcone
Internal ID | 46e93773-d306-4a9f-89aa-1a9c3f8977f9 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxychalcones |
IUPAC Name | 1-(2-hydroxy-4-methoxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
SMILES (Canonical) | COC1=CC=C(C=C1)C=CC(=O)C2=C(C=C(C=C2)OC)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)C=CC(=O)C2=C(C=C(C=C2)OC)O |
InChI | InChI=1S/C17H16O4/c1-20-13-6-3-12(4-7-13)5-10-16(18)15-9-8-14(21-2)11-17(15)19/h3-11,19H,1-2H3 |
InChI Key | OAAPAFSEMHJNTF-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C17H16O4 |
Molecular Weight | 284.31 g/mol |
Exact Mass | 284.10485899 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 4.00 |
DTXSID301347058 |
HMS3331B03 |
6'-hydroxy-4,4'-dimethoxychalcone |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
794.3 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.64% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.18% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 93.55% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.28% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.69% | 96.09% |
CHEMBL3194 | P02766 | Transthyretin | 89.98% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.42% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.42% | 96.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.63% | 95.50% |
CHEMBL2535 | P11166 | Glucose transporter | 86.56% | 98.75% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.34% | 99.15% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 84.99% | 96.12% |
CHEMBL2581 | P07339 | Cathepsin D | 81.80% | 98.95% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.56% | 91.07% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.70% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bidens tripartita |
PubChem | 98120 |
LOTUS | LTS0121252 |
wikiData | Q105188557 |