6-hydroxy-1H-indole-3-carbaldehyde
| Internal ID | 7f6c0a6b-447c-464f-b493-6f8706f0efe6 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Hydroxyindoles |
| IUPAC Name | 6-hydroxy-1H-indole-3-carbaldehyde |
| SMILES (Canonical) | C1=CC2=C(C=C1O)NC=C2C=O |
| SMILES (Isomeric) | C1=CC2=C(C=C1O)NC=C2C=O |
| InChI | InChI=1S/C9H7NO2/c11-5-6-4-10-9-3-7(12)1-2-8(6)9/h1-5,10,12H |
| InChI Key | FAFBOYSDWMRMLQ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.047678466 g/mol |
| Topological Polar Surface Area (TPSA) | 53.10 Ų |
| XlogP | 1.30 |
| 192184-71-7 |
| 6-Hydroxyindole-3-carboxaldehyde |
| 3-Formyl-6-hydroxyindole |
| 1H-Indole-3-carboxaldehyde, 6-hydroxy- |
| 6-Hydroxyindole-3-carbaldehyde |
| CHEMBL465344 |
| SCHEMBL15324073 |
| DTXSID20435577 |
| CHEBI:179267 |
| CS-B1236 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.09% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.02% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.96% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.02% | 95.56% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 92.80% | 98.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 89.42% | 98.35% |
| CHEMBL3194 | P02766 | Transthyretin | 88.59% | 90.71% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 86.78% | 93.24% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.78% | 89.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.59% | 90.00% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 85.49% | 83.10% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.38% | 91.71% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.19% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.95% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.71% | 98.95% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.18% | 95.56% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.17% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10103438 |
| LOTUS | LTS0114182 |
| wikiData | Q77625154 |