[6]-Gingerdiol 4'-O-beta-D-glucopyranoside
Internal ID | 66d8b591-9114-48df-a956-38a685e36651 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | 2-[4-(3,5-dihydroxydecyl)-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CCCCCC(CC(CCC1=CC(=C(C=C1)OC2C(C(C(C(O2)CO)O)O)O)OC)O)O |
SMILES (Isomeric) | CCCCCC(CC(CCC1=CC(=C(C=C1)OC2C(C(C(C(O2)CO)O)O)O)OC)O)O |
InChI | InChI=1S/C23H38O9/c1-3-4-5-6-15(25)12-16(26)9-7-14-8-10-17(18(11-14)30-2)31-23-22(29)21(28)20(27)19(13-24)32-23/h8,10-11,15-16,19-29H,3-7,9,12-13H2,1-2H3 |
InChI Key | NIZBVVCYJIIIMW-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H38O9 |
Molecular Weight | 458.50 g/mol |
Exact Mass | 458.25158279 g/mol |
Topological Polar Surface Area (TPSA) | 149.00 Ų |
XlogP | 1.00 |
CHEBI:172689 |
2-[4-(3,5-dihydroxydecyl)-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.80% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.75% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.17% | 99.17% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.70% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.16% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 91.93% | 92.08% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.49% | 86.33% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.49% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.47% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.42% | 95.89% |
CHEMBL1907 | P15144 | Aminopeptidase N | 87.88% | 93.31% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.76% | 96.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.16% | 94.73% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.96% | 92.94% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 83.83% | 90.20% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.81% | 94.45% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.59% | 93.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.99% | 86.92% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.85% | 92.62% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.72% | 90.71% |
CHEMBL2535 | P11166 | Glucose transporter | 80.22% | 98.75% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.21% | 97.14% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.03% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zingiber officinale |
PubChem | 85182103 |
LOTUS | LTS0071966 |
wikiData | Q105180046 |