6-(gamma,gamma-Dimethylallylamino)purine riboside
| Internal ID | 813a3124-3134-4f29-a1fa-31e2eafb1f1c |
| Taxonomy | Nucleosides, nucleotides, and analogues > Purine nucleosides |
| IUPAC Name | 2-(hydroxymethyl)-5-[6-(3-methylbut-2-enylamino)purin-9-yl]oxolane-3,4-diol |
| SMILES (Canonical) | CC(=CCNC1=C2C(=NC=N1)N(C=N2)C3C(C(C(O3)CO)O)O)C |
| SMILES (Isomeric) | CC(=CCNC1=C2C(=NC=N1)N(C=N2)C3C(C(C(O3)CO)O)O)C |
| InChI | InChI=1S/C15H21N5O4/c1-8(2)3-4-16-13-10-14(18-6-17-13)20(7-19-10)15-12(23)11(22)9(5-21)24-15/h3,6-7,9,11-12,15,21-23H,4-5H2,1-2H3,(H,16,17,18) |
| InChI Key | USVMJSALORZVDV-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H21N5O4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15935417 g/mol |
| Topological Polar Surface Area (TPSA) | 126.00 Ų |
| XlogP | 1.10 |
| Dimethylallyladenosine |
| NSC105546 |
| N6-(.DELTA.2-Isopentenyl)adenosine |
| SQ 22,558 |
| Isopentenyl adenine riboside |
| 6-(.gamma.,.gamma.-Dimethylallylamino)purine riboside |
| 9.beta.-D-Ribofuranosyl-9H-purine, N-(3-methyl-2-butenylamino)- |
| SQ 22558 |
| ZK 20 242 |
| MFCD00005741 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3589 | P55263 | Adenosine kinase | 98.34% | 98.05% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.46% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 95.13% | 95.93% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 94.82% | 94.73% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 94.40% | 91.38% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.69% | 91.11% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 90.33% | 93.10% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 89.11% | 80.33% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 87.12% | 95.83% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.98% | 99.17% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.08% | 96.90% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.58% | 94.00% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 83.16% | 95.64% |
| CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 83.13% | 96.67% |
| CHEMBL3137261 | O14744 | PRMT5/MEP50 complex | 82.77% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.09% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.75% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arabidopsis thaliana |
| PubChem | 266767 |
| LOTUS | LTS0120755 |
| wikiData | Q104667557 |