6-Epi-monanchorin
| Internal ID | 4787f9d3-4730-4f19-b511-b6a8dd63eed6 |
| Taxonomy | Organoheterocyclic compounds > Diazepines > 1,3-diazepines |
| IUPAC Name | (1R,5R,7S)-7-pentyl-6-oxa-2,4-diazabicyclo[3.2.2]non-3-en-3-amine |
| SMILES (Canonical) | CCCCCC1C2CCC(O1)N=C(N2)N |
| SMILES (Isomeric) | CCCCC[C@H]1[C@H]2CC[C@@H](O1)N=C(N2)N |
| InChI | InChI=1S/C11H21N3O/c1-2-3-4-5-9-8-6-7-10(15-9)14-11(12)13-8/h8-10H,2-7H2,1H3,(H3,12,13,14)/t8-,9+,10-/m1/s1 |
| InChI Key | RVYXBEHIFHTIKB-KXUCPTDWSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.168462302 g/mol |
| Topological Polar Surface Area (TPSA) | 59.60 Ų |
| XlogP | 1.60 |
| CHEMBL4575778 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.64% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.15% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.37% | 97.09% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 91.16% | 90.24% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.71% | 94.45% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.10% | 95.50% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 86.81% | 94.55% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.75% | 98.95% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 84.70% | 95.93% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.04% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.35% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.07% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 49793699 |
| LOTUS | LTS0085433 |
| wikiData | Q105246394 |