6-deca-1,3-dienyl-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ol
| Internal ID | eb6538b3-da42-420f-a0e5-acd163b1c8aa |
| Taxonomy | Organoheterocyclic compounds > Quinolizines |
| IUPAC Name | 6-deca-1,3-dienyl-4-methyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C20H35NO/c1-3-4-5-6-7-8-9-10-12-18-13-11-14-19-15-16-20(22)17(2)21(18)19/h8-10,12,17-20,22H,3-7,11,13-16H2,1-2H3 |
| InChI Key | BWYKUGCLFVUKMC-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.50 g/mol |
| Exact Mass | 305.271864740 g/mol |
| Topological Polar Surface Area (TPSA) | 23.50 Ų |
| XlogP | 5.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.18% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.85% | 96.09% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 92.46% | 100.00% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 91.79% | 97.47% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.96% | 92.08% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 90.22% | 97.29% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 90.12% | 91.81% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.45% | 99.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.42% | 97.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.20% | 96.47% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.30% | 95.50% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 84.59% | 85.94% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.52% | 92.86% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 84.15% | 94.66% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 83.48% | 95.58% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 83.46% | 80.33% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 83.41% | 96.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.34% | 93.56% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 83.12% | 86.67% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.01% | 95.89% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 82.78% | 92.38% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.68% | 99.18% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.36% | 90.24% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.53% | 89.62% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.15% | 97.25% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 80.15% | 90.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73836239 |
| LOTUS | LTS0068908 |
| wikiData | Q104947803 |