(6-Butyl-3-isothiocyanato-1,2,3,4,6,7,8,8a,9,10,11,12-dodecahydrobenzo[j]quinolizin-8-yl) acetate
| Internal ID | 182795d0-0c78-49c8-9ba4-530c1c6718d9 |
| Taxonomy | Organoheterocyclic compounds > Quinolizidines |
| IUPAC Name | (6-butyl-3-isothiocyanato-1,2,3,4,6,7,8,8a,9,10,11,12-dodecahydrobenzo[j]quinolizin-8-yl) acetate |
| SMILES (Canonical) | CCCCC1CC(C2CCCCC23N1CC(CC3)N=C=S)OC(=O)C |
| SMILES (Isomeric) | CCCCC1CC(C2CCCCC23N1CC(CC3)N=C=S)OC(=O)C |
| InChI | InChI=1S/C20H32N2O2S/c1-3-4-7-17-12-19(24-15(2)23)18-8-5-6-10-20(18)11-9-16(21-14-25)13-22(17)20/h16-19H,3-13H2,1-2H3 |
| InChI Key | IXONKJHYKDTHBP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H32N2O2S |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.21844944 g/mol |
| Topological Polar Surface Area (TPSA) | 74.00 Ų |
| XlogP | 5.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.49% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.29% | 96.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 95.93% | 95.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.80% | 98.95% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 95.01% | 94.08% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.78% | 96.61% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.11% | 89.63% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.66% | 94.45% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 92.87% | 91.81% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.94% | 82.69% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 91.91% | 100.00% |
| CHEMBL3837 | P07711 | Cathepsin L | 91.44% | 96.61% |
| CHEMBL4072 | P07858 | Cathepsin B | 91.35% | 93.67% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.97% | 92.86% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.43% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.66% | 97.09% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 88.93% | 95.38% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.98% | 91.19% |
| CHEMBL238 | Q01959 | Dopamine transporter | 87.44% | 95.88% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 87.44% | 95.58% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.23% | 95.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.97% | 93.56% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 86.90% | 98.33% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.83% | 100.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.68% | 96.95% |
| CHEMBL233 | P35372 | Mu opioid receptor | 83.97% | 97.93% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 83.58% | 96.25% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.54% | 97.50% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 83.54% | 98.10% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 83.46% | 82.38% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.00% | 95.89% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.62% | 97.28% |
| CHEMBL4608 | P33032 | Melanocortin receptor 5 | 81.09% | 97.00% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 81.07% | 94.23% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.02% | 97.21% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.82% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73821844 |
| LOTUS | LTS0079507 |
| wikiData | Q105122327 |