6-bromo-5-hydroxy-1H-indole-3-carbaldehyde
| Internal ID | 2e9092a9-38c3-442e-8305-6c21f85b4126 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Hydroxyindoles |
| IUPAC Name | 6-bromo-5-hydroxy-1H-indole-3-carbaldehyde |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C9H6BrNO2/c10-7-2-8-6(1-9(7)13)5(4-12)3-11-8/h1-4,11,13H |
| InChI Key | JNNHOMADZPJFMA-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C9H6BrNO2 |
| Molecular Weight | 240.05 g/mol |
| Exact Mass | 238.95819 g/mol |
| Topological Polar Surface Area (TPSA) | 53.10 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 97.88% | 98.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.42% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.97% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.63% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.17% | 94.45% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 88.32% | 83.10% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.96% | 93.40% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.81% | 92.94% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.25% | 89.62% |
| CHEMBL3194 | P02766 | Transthyretin | 84.26% | 90.71% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 83.01% | 95.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.10% | 92.88% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.56% | 94.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.35% | 89.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.86% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.54% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 23427613 |
| LOTUS | LTS0223261 |
| wikiData | Q105132024 |