6-Benzoyl-5,7-dihydroxy-8-(3-methylbut-2-enyl)-4-phenyl-3,4-dihydrochromen-2-one
| Internal ID | dd1e5b53-fbff-46f3-aea2-07d453ef28e3 |
| Taxonomy | Phenylpropanoids and polyketides > Neoflavonoids > Prenylated neoflavonoids |
| IUPAC Name | 6-benzoyl-5,7-dihydroxy-8-(3-methylbut-2-enyl)-4-phenyl-3,4-dihydrochromen-2-one |
| SMILES (Canonical) | CC(=CCC1=C(C(=C(C2=C1OC(=O)CC2C3=CC=CC=C3)O)C(=O)C4=CC=CC=C4)O)C |
| SMILES (Isomeric) | CC(=CCC1=C(C(=C(C2=C1OC(=O)CC2C3=CC=CC=C3)O)C(=O)C4=CC=CC=C4)O)C |
| InChI | InChI=1S/C27H24O5/c1-16(2)13-14-19-25(30)23(24(29)18-11-7-4-8-12-18)26(31)22-20(15-21(28)32-27(19)22)17-9-5-3-6-10-17/h3-13,20,30-31H,14-15H2,1-2H3 |
| InChI Key | UWODZFLDNNEEOB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C27H24O5 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.16237386 g/mol |
| Topological Polar Surface Area (TPSA) | 83.80 Ų |
| XlogP | 6.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.53% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.95% | 90.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.82% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.92% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.17% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.80% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.72% | 94.73% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.64% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.19% | 89.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.96% | 93.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.31% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.31% | 95.50% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.32% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vismia guianensis |
| PubChem | 10094089 |
| LOTUS | LTS0134755 |
| wikiData | Q105280473 |