(Z)-Mycophenolic Acid
| Internal ID | fd1adb93-fc75-45cb-80a8-e82bb7bf3f96 |
| Taxonomy | Organoheterocyclic compounds > Isocoumarans > Isobenzofuranones > Phthalides |
| IUPAC Name | 6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H20O6/c1-9(5-7-13(18)19)4-6-11-15(20)14-12(8-23-17(14)21)10(2)16(11)22-3/h4,20H,5-8H2,1-3H3,(H,18,19) |
| InChI Key | HPNSFSBZBAHARI-UHFFFAOYSA-N |
| Popularity | 4,746 references in papers |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.12598835 g/mol |
| Topological Polar Surface Area (TPSA) | 93.10 Ų |
| XlogP | 3.20 |
| Prestwick0_000556 |
| Prestwick1_000556 |
| Spectrum2_000892 |
| Spectrum3_000797 |
| Spectrum4_000890 |
| Oprea1_330442 |
| KBioGR_001300 |
| KBioSS_002544 |
| DivK1c_000146 |
| SPBio_000704 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1822 | P20839 | Inosine-5'-monophosphate dehydrogenase 1 |
19 nM |
IC50 |
via Super-PRED
|
| CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 |
7 nM |
Ki |
via Super-PRED
|
| CHEMBL1293235 | P02545 | Prelamin-A/C |
141.3 nM |
Potency |
via Super-PRED
|
| CHEMBL1293232 | Q16637 | Survival motor neuron protein |
63.1 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.75% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.68% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.96% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.88% | 99.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.87% | 99.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.16% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.60% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.33% | 85.14% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.51% | 91.19% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.08% | 94.73% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.07% | 95.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.46% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.34% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.02% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.58% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 4272 |
| LOTUS | LTS0101803 |
| wikiData | Q27164271 |