6-[4-(3,4-Dihydroxyphenyl)-2-hydroxyphenoxy]-2,8-dihydroxydibenzofuran-3-carboxylic acid
| Internal ID | 006a184e-09b4-4ac3-b447-d1d0283cdf13 |
| Taxonomy | Organoheterocyclic compounds > Benzofurans > Dibenzofurans |
| IUPAC Name | 6-[4-(3,4-dihydroxyphenyl)-2-hydroxyphenoxy]-2,8-dihydroxydibenzofuran-3-carboxylic acid |
| SMILES (Canonical) | C1=CC(=C(C=C1C2=CC(=C(C=C2)OC3=CC(=CC4=C3OC5=CC(=C(C=C54)O)C(=O)O)O)O)O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1C2=CC(=C(C=C2)OC3=CC(=CC4=C3OC5=CC(=C(C=C54)O)C(=O)O)O)O)O)O |
| InChI | InChI=1S/C25H16O9/c26-13-7-15-14-9-18(28)16(25(31)32)10-22(14)34-24(15)23(8-13)33-21-4-2-12(6-20(21)30)11-1-3-17(27)19(29)5-11/h1-10,26-30H,(H,31,32) |
| InChI Key | VRTKLDOVWDISRQ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C25H16O9 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.07943208 g/mol |
| Topological Polar Surface Area (TPSA) | 161.00 Ų |
| XlogP | 5.10 |
| BDBM50225277 |
| 2,8-dihydroxy-6-(3,3'',4''-trihydroxy-biphenyl-4-yloxy)-dibenzofuran-3-carboxylic acid |
![2D Structure of 6-[4-(3,4-Dihydroxyphenyl)-2-hydroxyphenoxy]-2,8-dihydroxydibenzofuran-3-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/6-4-34-dihydroxyphenyl-2-hydroxyphenoxy-28-dihydroxydibenzofuran-3-carboxylic-acid.jpg "2D Structure of 6-[4-(3,4-Dihydroxyphenyl)-2-hydroxyphenoxy]-2,8-dihydroxydibenzofuran-3-carboxylic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3194 | P02766 | Transthyretin | 98.06% | 90.71% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.07% | 99.15% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.16% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.44% | 94.45% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 91.88% | 87.67% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 91.07% | 81.11% |
| CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 90.29% | 95.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.98% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.26% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.82% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.27% | 95.56% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.03% | 83.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.02% | 94.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 87.13% | 94.42% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 86.41% | 96.09% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 86.30% | 95.78% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.56% | 95.50% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 85.07% | 80.78% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.67% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.33% | 89.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 82.96% | 90.20% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 82.00% | 98.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 24178900 |
| LOTUS | LTS0006961 |
| wikiData | Q105291953 |