6-(3,7-Dimethylocta-2,6-dienyl)-5,7-dihydroxy-2-(2,4,6-trihydroxyphenyl)-2,3-dihydrochromen-4-one
| Internal ID | f02b39f5-6fe3-41cc-8506-52980e448282 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 6-prenylated flavans > 6-prenylated flavanones |
| IUPAC Name | 6-(3,7-dimethylocta-2,6-dienyl)-5,7-dihydroxy-2-(2,4,6-trihydroxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES (Canonical) | CC(=CCCC(=CCC1=C(C2=C(C=C1O)OC(CC2=O)C3=C(C=C(C=C3O)O)O)O)C)C |
| SMILES (Isomeric) | CC(=CCCC(=CCC1=C(C2=C(C=C1O)OC(CC2=O)C3=C(C=C(C=C3O)O)O)O)C)C |
| InChI | InChI=1S/C25H28O7/c1-13(2)5-4-6-14(3)7-8-16-17(27)11-22-24(25(16)31)20(30)12-21(32-22)23-18(28)9-15(26)10-19(23)29/h5,7,9-11,21,26-29,31H,4,6,8,12H2,1-3H3 |
| InChI Key | BUPCGIYSKREVMZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18350323 g/mol |
| Topological Polar Surface Area (TPSA) | 127.00 Ų |
| XlogP | 5.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.41% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.95% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.36% | 94.45% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 93.83% | 92.68% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 92.26% | 96.12% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.05% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.54% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.07% | 99.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.42% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.16% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.50% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.07% | 90.71% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.45% | 89.34% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.22% | 100.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.94% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.43% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.97% | 86.33% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 80.09% | 95.64% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Sophora koreensis |
| Sophora tomentosa |
| PubChem | 74819407 |
| LOTUS | LTS0144578 |
| wikiData | Q104946212 |