6-(3,7-dimethylocta-2,5-dienyl)-4-hydroxy-3-methyl-5-propyl-1H-pyridin-2-one
| Internal ID | 2a84037f-ef1e-4594-b95f-fb5a170c332d |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Hydropyridines > Pyridinones |
| IUPAC Name | 6-(3,7-dimethylocta-2,5-dienyl)-4-hydroxy-3-methyl-5-propyl-1H-pyridin-2-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C19H29NO2/c1-6-8-16-17(20-19(22)15(5)18(16)21)12-11-14(4)10-7-9-13(2)3/h7,9,11,13H,6,8,10,12H2,1-5H3,(H2,20,21,22) |
| InChI Key | HVAVEUHAOCVIPN-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.219829168 g/mol |
| Topological Polar Surface Area (TPSA) | 49.30 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 95.60% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 95.39% | 94.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.68% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.05% | 94.73% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 91.03% | 98.59% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.83% | 91.11% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 89.83% | 89.34% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.04% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.72% | 98.75% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.83% | 97.21% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.12% | 85.14% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.52% | 90.71% |
| CHEMBL4072 | P07858 | Cathepsin B | 81.85% | 93.67% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.75% | 92.68% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.42% | 93.56% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.25% | 83.10% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.14% | 99.23% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.14% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 57347583 |
| LOTUS | LTS0131675 |
| wikiData | Q104168427 |