6-(3,3-Dimethylallyl)galangin
Internal ID | 8c970fb3-3170-41fe-b3dd-636534cd174f |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > 6-prenylated flavones |
IUPAC Name | 3,5,7-trihydroxy-6-(3-methylbut-2-enyl)-2-phenylchromen-4-one |
SMILES (Canonical) | CC(=CCC1=C(C2=C(C=C1O)OC(=C(C2=O)O)C3=CC=CC=C3)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C2=C(C=C1O)OC(=C(C2=O)O)C3=CC=CC=C3)O)C |
InChI | InChI=1S/C20H18O5/c1-11(2)8-9-13-14(21)10-15-16(17(13)22)18(23)19(24)20(25-15)12-6-4-3-5-7-12/h3-8,10,21-22,24H,9H2,1-2H3 |
InChI Key | DLUFCWQGHRQRMG-UHFFFAOYSA-N |
Popularity | 5 references in papers |
Molecular Formula | C20H18O5 |
Molecular Weight | 338.40 g/mol |
Exact Mass | 338.11542367 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 4.80 |
6-(3,3-DMA)galangin |
CHEBI:2160 |
3,5,7-Trihydroxy-6-prenylflavone |
6-prenyl-galangin |
SCHEMBL5072293 |
CHEMBL2165002 |
3,5,7-trihydroxy-6-(3-methylbut-2-enyl)-2-phenylchromen-4-one |
LMPK12111640 |
Q27105566 |
3,5,7-trihydroxy-6-(3-methylbut-2-en-1-yl)-2-phenyl-4H-1-benzopyran-4-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.47% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.33% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.47% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.38% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.19% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.87% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.02% | 89.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.76% | 85.14% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.91% | 95.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.03% | 99.23% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 82.49% | 95.64% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.88% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.61% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.21% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Glycyrrhiza lepidota |
PubChem | 5281945 |
LOTUS | LTS0052766 |
wikiData | Q27105566 |