CID 122216288
| Internal ID | 2b7cbd8a-e6bd-46c8-b19d-ddaa6dc4aec2 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolines |
| IUPAC Name | 6-(3-methylbut-2-enyl)-3-propan-2-ylidene-1H-indol-2-one |
| SMILES (Canonical) | CC(=CCC1=CC2=C(C=C1)C(=C(C)C)C(=O)N2)C |
| SMILES (Isomeric) | CC(=CCC1=CC2=C(C=C1)C(=C(C)C)C(=O)N2)C |
| InChI | InChI=1S/C16H19NO/c1-10(2)5-6-12-7-8-13-14(9-12)17-16(18)15(13)11(3)4/h5,7-9H,6H2,1-4H3,(H,17,18) |
| InChI Key | DXUIVKIVTFTDKE-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.146664230 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 4.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.79% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.39% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.68% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.67% | 90.17% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.60% | 91.49% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 89.73% | 89.34% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 89.60% | 90.24% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.52% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.48% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.45% | 94.73% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.87% | 90.00% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 85.75% | 97.28% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.59% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.56% | 86.33% |
| CHEMBL4578 | Q14680 | Maternal embryonic leucine zipper kinase | 83.23% | 81.58% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.65% | 96.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.31% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 122216288 |
| LOTUS | LTS0150816 |
| wikiData | Q104991196 |