6-(3-Hydroxy-4-methylphenyl)-2-methylhept-2-en-4-one
| Internal ID | c664ca09-d2e5-4698-902f-a1e537aa1ed9 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 6-(3-hydroxy-4-methylphenyl)-2-methylhept-2-en-4-one |
| SMILES (Canonical) | CC1=C(C=C(C=C1)C(C)CC(=O)C=C(C)C)O |
| SMILES (Isomeric) | CC1=C(C=C(C=C1)C(C)CC(=O)C=C(C)C)O |
| InChI | InChI=1S/C15H20O2/c1-10(2)7-14(16)8-12(4)13-6-5-11(3)15(17)9-13/h5-7,9,12,17H,8H2,1-4H3 |
| InChI Key | OSIFVLKZUWRNBN-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.146329876 g/mol |
| Topological Polar Surface Area (TPSA) | 37.30 Ų |
| XlogP | 3.60 |
| 139085-16-8 |
| 2-Hepten-4-one, 6-(3-hydroxy-4-methylphenyl)-2-methyl- |
| SCHEMBL6421262 |
| 2-Methyl-6-(3-hydroxy-4-methylphenyl)-2-hepten-4-one |
| DTXSID90578925 |
| OSIFVLKZUWRNBN-UHFFFAOYSA-N |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.08% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.33% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 95.70% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.19% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.50% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.95% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.70% | 99.15% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.30% | 97.21% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.16% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.44% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.55% | 90.71% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.23% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Curcuma longa |
| Osmunda regalis |
| PubChem | 15858385 |
| LOTUS | LTS0083747 |
| wikiData | Q105118886 |