[6-(2-Hydroxypropan-2-yl)-3-methyl-9-methylidene-8-oxocyclodec-2-en-1-yl] acetate
| Internal ID | 6bcc1aff-cc1c-462f-936b-6e521e0ede1d |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Germacrane sesquiterpenoids |
| IUPAC Name | [6-(2-hydroxypropan-2-yl)-3-methyl-9-methylidene-8-oxocyclodec-2-en-1-yl] acetate |
| SMILES (Canonical) | CC1=CC(CC(=C)C(=O)CC(CC1)C(C)(C)O)OC(=O)C |
| SMILES (Isomeric) | CC1=CC(CC(=C)C(=O)CC(CC1)C(C)(C)O)OC(=O)C |
| InChI | InChI=1S/C17H26O4/c1-11-6-7-14(17(4,5)20)10-16(19)12(2)9-15(8-11)21-13(3)18/h8,14-15,20H,2,6-7,9-10H2,1,3-5H3 |
| InChI Key | ZPZUGHMDLKWJOU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18310931 g/mol |
| Topological Polar Surface Area (TPSA) | 63.60 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
![2D Structure of [6-(2-Hydroxypropan-2-yl)-3-methyl-9-methylidene-8-oxocyclodec-2-en-1-yl] acetate](https://plantaedb.com/storage/docs/compounds/2023/11/6-2-hydroxypropan-2-yl-3-methyl-9-methylidene-8-oxocyclodec-2-en-1-yl-acetate.jpg "2D Structure of [6-(2-Hydroxypropan-2-yl)-3-methyl-9-methylidene-8-oxocyclodec-2-en-1-yl] acetate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.33% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.09% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.46% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.09% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.95% | 99.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.41% | 96.09% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 83.90% | 90.93% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.84% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.21% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.07% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.95% | 86.33% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.88% | 93.04% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.10% | 93.03% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.10% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Tanacetum vulgare |
| PubChem | 92012797 |
| LOTUS | LTS0050711 |
| wikiData | Q105381349 |