6-(2-Ethoxyethyl)-7-(ethoxymethyl)-2-(hydroxymethyl)-2,5-dimethyl-1,3-dihydroinden-4-ol
| Internal ID | f7c49061-36af-416b-a865-31e1ecab01a5 |
| Taxonomy | Benzenoids > Indanes |
| IUPAC Name | 6-(2-ethoxyethyl)-7-(ethoxymethyl)-2-(hydroxymethyl)-2,5-dimethyl-1,3-dihydroinden-4-ol |
| SMILES (Canonical) | CCOCCC1=C(C(=C2CC(CC2=C1COCC)(C)CO)O)C |
| SMILES (Isomeric) | CCOCCC1=C(C(=C2CC(CC2=C1COCC)(C)CO)O)C |
| InChI | InChI=1S/C19H30O4/c1-5-22-8-7-14-13(3)18(21)16-10-19(4,12-20)9-15(16)17(14)11-23-6-2/h20-21H,5-12H2,1-4H3 |
| InChI Key | ONNQZXKALMLUSK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.21440943 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 2.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 93.63% | 92.68% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.60% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.90% | 96.09% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 87.08% | 98.35% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.74% | 90.24% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.33% | 94.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.09% | 98.95% |
| CHEMBL240 | Q12809 | HERG | 84.58% | 89.76% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.42% | 91.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.98% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.11% | 97.09% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 82.87% | 97.64% |
| CHEMBL236 | P41143 | Delta opioid receptor | 82.62% | 99.35% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 82.25% | 85.49% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.16% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.09% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.97% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.63% | 95.89% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.93% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 74434358 |
| LOTUS | LTS0221276 |
| wikiData | Q104193548 |