6-[2-(2,6-Dimethoxy-4-prop-2-enylphenoxy)propyl]-4-methoxy-1,3-benzodioxole
| Internal ID | 6cbefbeb-f07f-4d37-a570-91a5f416c5d4 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Methoxybenzenes > Dimethoxybenzenes |
| IUPAC Name | 6-[2-(2,6-dimethoxy-4-prop-2-enylphenoxy)propyl]-4-methoxy-1,3-benzodioxole |
| SMILES (Canonical) | CC(CC1=CC2=C(C(=C1)OC)OCO2)OC3=C(C=C(C=C3OC)CC=C)OC |
| SMILES (Isomeric) | CC(CC1=CC2=C(C(=C1)OC)OCO2)OC3=C(C=C(C=C3OC)CC=C)OC |
| InChI | InChI=1S/C22H26O6/c1-6-7-15-9-18(24-4)22(19(10-15)25-5)28-14(2)8-16-11-17(23-3)21-20(12-16)26-13-27-21/h6,9-12,14H,1,7-8,13H2,2-5H3 |
| InChI Key | KMIKEENHZISTPD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.17293854 g/mol |
| Topological Polar Surface Area (TPSA) | 55.40 Ų |
| XlogP | 5.10 |
| There are no found synonyms. |
![2D Structure of 6-[2-(2,6-Dimethoxy-4-prop-2-enylphenoxy)propyl]-4-methoxy-1,3-benzodioxole](https://plantaedb.com/storage/docs/compounds/2023/11/6-2-26-dimethoxy-4-prop-2-enylphenoxypropyl-4-methoxy-13-benzodioxole.jpg "2D Structure of 6-[2-(2,6-Dimethoxy-4-prop-2-enylphenoxy)propyl]-4-methoxy-1,3-benzodioxole")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.83% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.72% | 94.45% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 94.02% | 96.77% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.34% | 98.95% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.82% | 95.17% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.78% | 89.62% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.16% | 92.62% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 90.46% | 89.44% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 89.14% | 89.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.12% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.97% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.68% | 93.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.64% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.64% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.73% | 96.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.40% | 95.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.96% | 90.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.05% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Licaria aurea |
| PubChem | 14464323 |
| LOTUS | LTS0063065 |
| wikiData | Q105142978 |