6-[(1S)-1-[(2S)-3-hydroxy-2-methoxypropanoyl]oxyethyl]phenazine-1-carboxylic acid
| Internal ID | 8fa3e199-efed-48b7-bc7b-1d7e95b07d5b |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinoxalines > Phenazines and derivatives |
| IUPAC Name | 6-[(1S)-1-[(2S)-3-hydroxy-2-methoxypropanoyl]oxyethyl]phenazine-1-carboxylic acid |
| SMILES (Canonical) | CC(C1=C2C(=CC=C1)N=C3C(=N2)C=CC=C3C(=O)O)OC(=O)C(CO)OC |
| SMILES (Isomeric) | C[C@@H](C1=C2C(=CC=C1)N=C3C(=N2)C=CC=C3C(=O)O)OC(=O)[C@H](CO)OC |
| InChI | InChI=1S/C19H18N2O6/c1-10(27-19(25)15(9-22)26-2)11-5-3-7-13-16(11)20-14-8-4-6-12(18(23)24)17(14)21-13/h3-8,10,15,22H,9H2,1-2H3,(H,23,24)/t10-,15-/m0/s1 |
| InChI Key | OSEDIRANPWGFRX-BONVTDFDSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.11648630 g/mol |
| Topological Polar Surface Area (TPSA) | 119.00 Ų |
| XlogP | 1.50 |
| There are no found synonyms. |
![2D Structure of 6-[(1S)-1-[(2S)-3-hydroxy-2-methoxypropanoyl]oxyethyl]phenazine-1-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/6-1s-1-2s-3-hydroxy-2-methoxypropanoyloxyethylphenazine-1-carboxylic-acid.jpg "2D Structure of 6-[(1S)-1-[(2S)-3-hydroxy-2-methoxypropanoyl]oxyethyl]phenazine-1-carboxylic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.55% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.02% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.87% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.41% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.23% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.40% | 96.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.89% | 99.23% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.20% | 95.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.15% | 93.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.22% | 94.73% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.47% | 97.36% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 83.33% | 81.11% |
| CHEMBL3891 | P07384 | Calpain 1 | 82.12% | 93.04% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.91% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101834249 |
| LOTUS | LTS0212816 |
| wikiData | Q105198816 |