6-(1-Hydroxy-3-oxobutyl)-7-methoxycoumarin
Internal ID | 287ca68a-d2a6-45d3-8c67-f2d64f730f71 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
IUPAC Name | 6-(1-hydroxy-3-oxobutyl)-7-methoxychromen-2-one |
SMILES (Canonical) | CC(=O)CC(C1=C(C=C2C(=C1)C=CC(=O)O2)OC)O |
SMILES (Isomeric) | CC(=O)CC(C1=C(C=C2C(=C1)C=CC(=O)O2)OC)O |
InChI | InChI=1S/C14H14O5/c1-8(15)5-11(16)10-6-9-3-4-14(17)19-12(9)7-13(10)18-2/h3-4,6-7,11,16H,5H2,1-2H3 |
InChI Key | IKTQFLXJWYKGDA-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C14H14O5 |
Molecular Weight | 262.26 g/mol |
Exact Mass | 262.08412354 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 0.70 |
6-(1-hydroxy-3-oxobutyl)-7-methoxycoumarin |
6-(1-hydroxy-3-oxobutyl)-7-methoxychromen-2-one |
6-(1-hydroxy-3-oxobutyl)-7-methoxy-2H-chromen-2-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.43% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.94% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.33% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.14% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.11% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.10% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.90% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.43% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.22% | 99.17% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 83.50% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citrus maxima |
PubChem | 101664569 |
LOTUS | LTS0026112 |
wikiData | Q105114931 |