(5Z)-4-(3,5-dibromo-4-hydroxyphenyl)-5-[(4-hydroxyphenyl)methylidene]furan-2-one
| Internal ID | 4e47f1e9-3842-4089-9aeb-2eedc9fa252e |
| Taxonomy | Benzenoids > Phenols > Halophenols > Bromophenols > O-bromophenols |
| IUPAC Name | (5Z)-4-(3,5-dibromo-4-hydroxyphenyl)-5-[(4-hydroxyphenyl)methylidene]furan-2-one |
| SMILES (Canonical) | C1=CC(=CC=C1C=C2C(=CC(=O)O2)C3=CC(=C(C(=C3)Br)O)Br)O |
| SMILES (Isomeric) | C1=CC(=CC=C1/C=C\2/C(=CC(=O)O2)C3=CC(=C(C(=C3)Br)O)Br)O |
| InChI | InChI=1S/C17H10Br2O4/c18-13-6-10(7-14(19)17(13)22)12-8-16(21)23-15(12)5-9-1-3-11(20)4-2-9/h1-8,20,22H/b15-5- |
| InChI Key | CLSLZQUKHTYAEH-WCSRMQSCSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H10Br2O4 |
| Molecular Weight | 438.10 g/mol |
| Exact Mass | 437.89253 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 4.20 |
| There are no found synonyms. |
![2D Structure of (5Z)-4-(3,5-dibromo-4-hydroxyphenyl)-5-[(4-hydroxyphenyl)methylidene]furan-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/5z-4-35-dibromo-4-hydroxyphenyl-5-4-hydroxyphenylmethylidenefuran-2-one.jpg "2D Structure of (5Z)-4-(3,5-dibromo-4-hydroxyphenyl)-5-[(4-hydroxyphenyl)methylidene]furan-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.31% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.92% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.45% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.11% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.14% | 86.33% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 88.61% | 93.24% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 88.46% | 83.10% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 87.79% | 90.93% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.58% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.52% | 90.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.22% | 99.23% |
| CHEMBL3194 | P02766 | Transthyretin | 82.46% | 90.71% |
| CHEMBL3788 | O00444 | Serine/threonine-protein kinase PLK4 | 81.20% | 83.65% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.02% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10873829 |
| LOTUS | LTS0217617 |
| wikiData | Q104963883 |