(5Z)-2-amino-5-[(6-bromo-1H-indol-3-yl)methylidene]-3-methylimidazol-4-one
| Internal ID | 1914ed18-ed89-407c-a30a-c1472197fe24 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives |
| IUPAC Name | (5Z)-2-amino-5-[(6-bromo-1H-indol-3-yl)methylidene]-3-methylimidazol-4-one |
| SMILES (Canonical) | CN1C(=O)C(=CC2=CNC3=C2C=CC(=C3)Br)N=C1N |
| SMILES (Isomeric) | CN1C(=O)/C(=C/C2=CNC3=C2C=CC(=C3)Br)/N=C1N |
| InChI | InChI=1S/C13H11BrN4O/c1-18-12(19)11(17-13(18)15)4-7-6-16-10-5-8(14)2-3-9(7)10/h2-6,16H,1H3,(H2,15,17)/b11-4- |
| InChI Key | AKOYYWJWILIASW-WCIBSUBMSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H11BrN4O |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 318.01162 g/mol |
| Topological Polar Surface Area (TPSA) | 74.50 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
![2D Structure of (5Z)-2-amino-5-[(6-bromo-1H-indol-3-yl)methylidene]-3-methylimidazol-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/5z-2-amino-5-6-bromo-1h-indol-3-ylmethylidene-3-methylimidazol-4-one.jpg "2D Structure of (5Z)-2-amino-5-[(6-bromo-1H-indol-3-yl)methylidene]-3-methylimidazol-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.21% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.20% | 95.56% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 96.86% | 85.30% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.73% | 91.49% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 94.71% | 93.40% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.55% | 98.95% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.83% | 89.62% |
| CHEMBL5443 | O00311 | Cell division cycle 7-related protein kinase | 91.52% | 96.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.84% | 96.09% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 89.86% | 89.92% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 87.55% | 95.69% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.34% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.32% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.80% | 90.00% |
| CHEMBL3959 | P16083 | Quinone reductase 2 | 85.41% | 89.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.32% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.90% | 91.11% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 84.06% | 80.96% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 82.57% | 97.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.29% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 14446223 |
| LOTUS | LTS0073817 |
| wikiData | Q105096022 |