(5S,9S,13R)-3-oxa-1-azatricyclo[7.3.1.05,13]tridecane
| Internal ID | 7b80519f-2b89-44ee-ad47-5e14b5828a27 |
| Taxonomy | Organoheterocyclic compounds > Quinolidines |
| IUPAC Name | (5S,9S,13R)-3-oxa-1-azatricyclo[7.3.1.05,13]tridecane |
| SMILES (Canonical) | C1CC2CCCN3C2C(C1)COC3 |
| SMILES (Isomeric) | C1C[C@H]2CCCN3[C@H]2[C@H](C1)COC3 |
| InChI | InChI=1S/C11H19NO/c1-3-9-5-2-6-12-8-13-7-10(4-1)11(9)12/h9-11H,1-8H2/t9-,10+,11+/m0/s1 |
| InChI Key | UMXDWOAONBMYJH-HBNTYKKESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.27 g/mol |
| Exact Mass | 181.146664230 g/mol |
| Topological Polar Surface Area (TPSA) | 12.50 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
![2D Structure of (5S,9S,13R)-3-oxa-1-azatricyclo[7.3.1.05,13]tridecane](https://plantaedb.com/storage/docs/compounds/2023/11/5s9s13r-3-oxa-1-azatricyclo7310513tridecane.jpg "2D Structure of (5S,9S,13R)-3-oxa-1-azatricyclo[7.3.1.05,13]tridecane")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 90.87% | 98.46% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.19% | 92.94% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.65% | 83.82% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.89% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.95% | 97.09% |
| CHEMBL240 | Q12809 | HERG | 84.54% | 89.76% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.52% | 95.89% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 83.33% | 99.18% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.83% | 96.09% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.92% | 95.50% |
| CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 80.81% | 93.90% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.42% | 98.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 12015755 |
| LOTUS | LTS0129001 |
| wikiData | Q105275805 |