(5S,8R)-3,8-dimethyl-5-propan-2-yl-5,6,7,8-tetrahydronaphthalen-2-ol
Internal ID | 37e1054c-d740-4440-a4ac-0fbe447e9da2 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | (5S,8R)-3,8-dimethyl-5-propan-2-yl-5,6,7,8-tetrahydronaphthalen-2-ol |
SMILES (Canonical) | CC1CCC(C2=C1C=C(C(=C2)C)O)C(C)C |
SMILES (Isomeric) | C[C@@H]1CC[C@H](C2=C1C=C(C(=C2)C)O)C(C)C |
InChI | InChI=1S/C15H22O/c1-9(2)12-6-5-10(3)13-8-15(16)11(4)7-14(12)13/h7-10,12,16H,5-6H2,1-4H3/t10-,12+/m1/s1 |
InChI Key | UTBFITAKBXMXCZ-PWSUYJOCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H22O |
Molecular Weight | 218.33 g/mol |
Exact Mass | 218.167065321 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 4.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.62% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 93.42% | 98.95% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 91.12% | 93.40% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 90.65% | 90.24% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 89.53% | 97.23% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.12% | 90.71% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.83% | 89.62% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 86.73% | 99.18% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.29% | 99.15% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.79% | 95.89% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.51% | 93.65% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.59% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.66% | 100.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.43% | 92.94% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.75% | 93.18% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.56% | 93.03% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.01% | 93.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.87% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.80% | 95.89% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.46% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ocotea elegans |
Packera tomentosa |
Platycarya strobilacea |
PubChem | 13368074 |
LOTUS | LTS0100241 |
wikiData | Q105278665 |