(5S,12E,14E)-tritriaconta-12,14-dien-5-ol
Internal ID | 38baf226-c1cf-4cd5-8570-dbf7c8fa0b70 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols |
IUPAC Name | (5S,12E,14E)-tritriaconta-12,14-dien-5-ol |
SMILES (Canonical) | CCCCCCCCCCCCCCCCCCC=CC=CCCCCCCC(CCCC)O |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCCC/C=C/C=C/CCCCCC[C@H](CCCC)O |
InChI | InChI=1S/C33H64O/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30-32-33(34)31-6-4-2/h22-25,33-34H,3-21,26-32H2,1-2H3/b23-22+,25-24+/t33-/m0/s1 |
InChI Key | CIJPSHANCVXCAK-SJOZGJFASA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H64O |
Molecular Weight | 476.90 g/mol |
Exact Mass | 476.495716661 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 14.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.24% | 97.29% |
CHEMBL2581 | P07339 | Cathepsin D | 95.42% | 98.95% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 94.94% | 92.86% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.06% | 92.08% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.87% | 99.17% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.67% | 89.63% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.43% | 96.09% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 90.26% | 91.81% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 90.13% | 85.94% |
CHEMBL1907 | P15144 | Aminopeptidase N | 88.62% | 93.31% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 88.28% | 87.45% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.58% | 93.56% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.37% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.40% | 96.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.70% | 90.17% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 80.05% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eragrostis curvula |
PubChem | 162903307 |
LOTUS | LTS0085699 |
wikiData | Q105025217 |