(5S)-5-(2,5-dibromo-1H-indol-3-yl)-4,5-dihydro-1H-imidazol-2-amine
| Internal ID | 4c63072f-3c3f-4f4e-a749-3a140afc33c8 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles > 3-alkylindoles |
| IUPAC Name | (5S)-5-(2,5-dibromo-1H-indol-3-yl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H10Br2N4/c12-5-1-2-7-6(3-5)9(10(13)16-7)8-4-15-11(14)17-8/h1-3,8,16H,4H2,(H3,14,15,17)/t8-/m1/s1 |
| InChI Key | WKESXLRJTZSTJI-MRVPVSSYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C11H10Br2N4 |
| Molecular Weight | 358.03 g/mol |
| Exact Mass | 357.92517 g/mol |
| Topological Polar Surface Area (TPSA) | 66.20 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 97.37% | 92.94% |
| CHEMBL5443 | O00311 | Cell division cycle 7-related protein kinase | 94.52% | 96.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.35% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.33% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.93% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.44% | 95.56% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 91.02% | 85.49% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 90.55% | 88.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.97% | 94.45% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.66% | 94.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.93% | 95.89% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 87.02% | 89.44% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 86.09% | 97.23% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.92% | 90.08% |
| CHEMBL1952 | P04818 | Thymidylate synthase | 83.71% | 93.53% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.24% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.84% | 98.75% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 80.34% | 85.30% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.19% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163191454 |
| LOTUS | LTS0228701 |
| wikiData | Q105307279 |