(5R,7R)-7-(1,3-benzodioxol-5-yl)-4,5,9-trimethoxy-6,7-dihydro-5H-furo[3,2-g]chromene
| Internal ID | f2911070-638d-4666-a3e2-4d6693f1747a |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Furanoflavonoids and dihydrofuranoflavonoids |
| IUPAC Name | (5R,7R)-7-(1,3-benzodioxol-5-yl)-4,5,9-trimethoxy-6,7-dihydro-5H-furo[3,2-g]chromene |
| SMILES (Canonical) | COC1CC(OC2=C(C3=C(C=CO3)C(=C12)OC)OC)C4=CC5=C(C=C4)OCO5 |
| SMILES (Isomeric) | CO[C@@H]1C[C@@H](OC2=C(C3=C(C=CO3)C(=C12)OC)OC)C4=CC5=C(C=C4)OCO5 |
| InChI | InChI=1S/C21H20O7/c1-22-16-9-14(11-4-5-13-15(8-11)27-10-26-13)28-20-17(16)18(23-2)12-6-7-25-19(12)21(20)24-3/h4-8,14,16H,9-10H2,1-3H3/t14-,16-/m1/s1 |
| InChI Key | OWINHPGFEPOUFB-GDBMZVCRSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.12090297 g/mol |
| Topological Polar Surface Area (TPSA) | 68.50 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
![2D Structure of (5R,7R)-7-(1,3-benzodioxol-5-yl)-4,5,9-trimethoxy-6,7-dihydro-5H-furo[3,2-g]chromene](https://plantaedb.com/storage/docs/compounds/2023/11/5r7r-7-13-benzodioxol-5-yl-459-trimethoxy-67-dihydro-5h-furo32-gchromene.jpg "2D Structure of (5R,7R)-7-(1,3-benzodioxol-5-yl)-4,5,9-trimethoxy-6,7-dihydro-5H-furo[3,2-g]chromene")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.55% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.71% | 94.45% |
| CHEMBL240 | Q12809 | HERG | 95.40% | 89.76% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 95.31% | 94.80% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.76% | 97.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.77% | 96.77% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 92.32% | 92.62% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.51% | 85.14% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 89.89% | 94.03% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 88.84% | 80.96% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 86.54% | 82.67% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 85.82% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.31% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.29% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.17% | 95.56% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.88% | 89.62% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.69% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.50% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.42% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.65% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lonchocarpus subglaucescens |
| PubChem | 101993928 |
| LOTUS | LTS0116106 |
| wikiData | Q105202030 |