(5R,6S)-2,2,6,9-tetramethyl-3,4,5,6-tetrahydro-1-benzoxocine-5,8-diol
Internal ID | 5d0594d6-cd13-41ea-ac64-d87bcd9e6f08 |
Taxonomy | Organoheterocyclic compounds > Oxocins |
IUPAC Name | (5R,6S)-2,2,6,9-tetramethyl-3,4,5,6-tetrahydro-1-benzoxocine-5,8-diol |
SMILES (Canonical) | CC1C(CCC(OC2=C1C=C(C(=C2)C)O)(C)C)O |
SMILES (Isomeric) | C[C@@H]1[C@@H](CCC(OC2=C1C=C(C(=C2)C)O)(C)C)O |
InChI | InChI=1S/C15H22O3/c1-9-7-14-11(8-13(9)17)10(2)12(16)5-6-15(3,4)18-14/h7-8,10,12,16-17H,5-6H2,1-4H3/t10-,12+/m0/s1 |
InChI Key | AGFRLVLITCCIDO-CMPLNLGQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H22O3 |
Molecular Weight | 250.33 g/mol |
Exact Mass | 250.15689456 g/mol |
Topological Polar Surface Area (TPSA) | 49.70 Ų |
XlogP | 3.00 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.49% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 88.81% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.89% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.87% | 92.94% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.32% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.92% | 89.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 85.94% | 90.24% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.67% | 93.40% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.15% | 97.09% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 83.07% | 91.79% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.80% | 95.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.74% | 94.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.69% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.18% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Helianthus annuus |
PubChem | 101264042 |
LOTUS | LTS0216248 |
wikiData | Q104911743 |