(5R)-Dihydro-5-methyl-5-[(4R,8R)-4,8,12-trimethyltridecyl]-2(3H)-furanone
| Internal ID | d6defdd0-fa56-4511-b95a-07e41801840d |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
| IUPAC Name | (5R)-5-methyl-5-[(4R,8R)-4,8,12-trimethyltridecyl]oxolan-2-one |
| SMILES (Canonical) | CC(C)CCCC(C)CCCC(C)CCCC1(CCC(=O)O1)C |
| SMILES (Isomeric) | C[C@@H](CCC[C@@H](C)CCC[C@@]1(CCC(=O)O1)C)CCCC(C)C |
| InChI | InChI=1S/C21H40O2/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-15-21(5)16-14-20(22)23-21/h17-19H,6-16H2,1-5H3/t18-,19-,21-/m1/s1 |
| InChI Key | LGWNRNDWDZHUNP-SFHLNBCPSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H40O2 |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.302830514 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 7.90 |
| (5R)-Dihydro-5-methyl-5-[(4R,8R)-4,8,12-trimethyltridecyl]-2(3H)-furanone |
| 225668-83-7 |
![2D Structure of (5R)-Dihydro-5-methyl-5-[(4R,8R)-4,8,12-trimethyltridecyl]-2(3H)-furanone](https://plantaedb.com/storage/docs/compounds/2023/11/5r-dihydro-5-methyl-5-4r8r-4812-trimethyltridecyl-23h-furanone.jpg "2D Structure of (5R)-Dihydro-5-methyl-5-[(4R,8R)-4,8,12-trimethyltridecyl]-2(3H)-furanone")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.70% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.52% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.09% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.79% | 90.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.67% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.19% | 95.56% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 83.06% | 98.03% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.66% | 97.25% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 82.62% | 92.12% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 82.27% | 93.31% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.99% | 94.75% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 81.08% | 94.66% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.47% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cyperus conglomeratus |
| PubChem | 101346170 |
| LOTUS | LTS0064007 |
| wikiData | Q105151607 |