(5R)-3-Hexadecanoyl-4-hydroxy-5-(hydroxymethyl)furan-2(5H)-one
Internal ID | c91f91a3-311d-4d08-8195-b4a149a0377a |
Taxonomy | Organoheterocyclic compounds > Dihydrofurans > Furanones > Butenolides |
IUPAC Name | (2R)-4-hexadecanoyl-3-hydroxy-2-(hydroxymethyl)-2H-furan-5-one |
SMILES (Canonical) | CCCCCCCCCCCCCCCC(=O)C1=C(C(OC1=O)CO)O |
SMILES (Isomeric) | CCCCCCCCCCCCCCCC(=O)C1=C([C@H](OC1=O)CO)O |
InChI | InChI=1S/C21H36O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(23)19-20(24)18(16-22)26-21(19)25/h18,22,24H,2-16H2,1H3/t18-/m1/s1 |
InChI Key | KZTSLHQKWLYYAC-GOSISDBHSA-N |
Popularity | 40 references in papers |
Molecular Formula | C21H36O5 |
Molecular Weight | 368.50 g/mol |
Exact Mass | 368.25627424 g/mol |
Topological Polar Surface Area (TPSA) | 83.80 Ų |
XlogP | 6.70 |
Atomic LogP (AlogP) | 4.77 |
H-Bond Acceptor | 5 |
H-Bond Donor | 2 |
Rotatable Bonds | 16 |
CHEMBL426373 |
150627-37-5 |
(5R)-3-Hexadecanoyl-5-hydroxymethyltetronic acid |
D08BSQ |
SCHEMBL4403663 |
DTXSID50715652 |
BDBM50093526 |
RK-682, >=98% (HPLC) |
(5R)-3-Hexadecanoyl-4-hydroxy-5-(hydroxymethyl)furan-2(5H)-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.8754 | 87.54% |
Caco-2 | - | 0.6069 | 60.69% |
Blood Brain Barrier | - | 0.5072 | 50.72% |
Human oral bioavailability | - | 0.6714 | 67.14% |
Subcellular localzation | Mitochondria | 0.7983 | 79.83% |
OATP2B1 inhibitior | - | 0.8521 | 85.21% |
OATP1B1 inhibitior | + | 0.7810 | 78.10% |
OATP1B3 inhibitior | + | 0.9565 | 95.65% |
MATE1 inhibitior | - | 0.8412 | 84.12% |
OCT2 inhibitior | - | 0.5820 | 58.20% |
BSEP inhibitior | - | 0.6878 | 68.78% |
P-glycoprotein inhibitior | - | 0.6912 | 69.12% |
P-glycoprotein substrate | - | 0.7818 | 78.18% |
CYP3A4 substrate | - | 0.5445 | 54.45% |
CYP2C9 substrate | - | 0.8018 | 80.18% |
CYP2D6 substrate | - | 0.8858 | 88.58% |
CYP3A4 inhibition | - | 0.7974 | 79.74% |
CYP2C9 inhibition | - | 0.8535 | 85.35% |
CYP2C19 inhibition | - | 0.7470 | 74.70% |
CYP2D6 inhibition | - | 0.8798 | 87.98% |
CYP1A2 inhibition | - | 0.7590 | 75.90% |
CYP2C8 inhibition | - | 0.8844 | 88.44% |
CYP inhibitory promiscuity | - | 0.8723 | 87.23% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.7060 | 70.60% |
Eye corrosion | - | 0.9871 | 98.71% |
Eye irritation | + | 0.7310 | 73.10% |
Skin irritation | - | 0.5491 | 54.91% |
Skin corrosion | - | 0.9393 | 93.93% |
Ames mutagenesis | - | 0.9037 | 90.37% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5052 | 50.52% |
Micronuclear | - | 0.9100 | 91.00% |
Hepatotoxicity | - | 0.5589 | 55.89% |
skin sensitisation | - | 0.9176 | 91.76% |
Respiratory toxicity | - | 0.7444 | 74.44% |
Reproductive toxicity | - | 0.5444 | 54.44% |
Mitochondrial toxicity | - | 0.5250 | 52.50% |
Nephrotoxicity | + | 0.7187 | 71.87% |
Acute Oral Toxicity (c) | III | 0.5870 | 58.70% |
Estrogen receptor binding | - | 0.5685 | 56.85% |
Androgen receptor binding | - | 0.4847 | 48.47% |
Thyroid receptor binding | - | 0.4926 | 49.26% |
Glucocorticoid receptor binding | - | 0.4922 | 49.22% |
Aromatase binding | - | 0.7610 | 76.10% |
PPAR gamma | + | 0.7585 | 75.85% |
Honey bee toxicity | - | 0.9824 | 98.24% |
Biodegradation | - | 0.5500 | 55.00% |
Crustacea aquatic toxicity | + | 0.7038 | 70.38% |
Fish aquatic toxicity | + | 0.9636 | 96.36% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 |
11700 nM 11600 nM |
IC50 IC50 |
PMID: 11563920
PMID: 11563920 |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B |
4.5 nM 700 nM 4500 nM 4490 nM 4600 nM 4400 nM 4500 nM 4500 nM 4500 nM 4500 nM 4500 nM 4500 nM 4500 nM |
IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 IC50 |
via Super-PRED
via Super-PRED PMID: 25907369 PMID: 25819098 PMID: 24047800 PMID: 20724155 PMID: 19836230 PMID: 18288807 PMID: 18053716 PMID: 17489632 PMID: 17125223 PMID: 16580200 PMID: 16356713 |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase |
5100 nM |
IC50 |
PMID: 23387824
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.45% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 95.40% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.69% | 91.11% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.99% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.87% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.61% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.34% | 97.25% |
CHEMBL299 | P17252 | Protein kinase C alpha | 84.44% | 98.03% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.22% | 91.81% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 83.65% | 89.63% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 81.98% | 92.08% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.69% | 92.50% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.60% | 97.79% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.32% | 97.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Astilbe grandis |
Astilbe rubra |
Erythrina abyssinica |
Erythrina abyssinica |
Polytrichastrum alpinum |
Rhododendron brachycarpum |
PubChem | 54678922 |
NPASS | NPC47653 |
ChEMBL | CHEMBL426373 |
LOTUS | LTS0058547 |
wikiData | Q82652917 |