(5R)-2-methyl-5-[(2S)-1-oxopropan-2-yl]cyclopentene-1-carbaldehyde
| Internal ID | 113ef24c-fd8c-4298-8493-fc901978791a |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Monocyclic monoterpenoids |
| IUPAC Name | (5R)-2-methyl-5-[(2S)-1-oxopropan-2-yl]cyclopentene-1-carbaldehyde |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H14O2/c1-7-3-4-9(8(2)5-11)10(7)6-12/h5-6,8-9H,3-4H2,1-2H3/t8-,9-/m1/s1 |
| InChI Key | OPYIDDKLXUUEPE-RKDXNWHRSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.099379685 g/mol |
| Topological Polar Surface Area (TPSA) | 34.10 Ų |
| XlogP | 0.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.13% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.71% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.43% | 96.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.01% | 96.47% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 84.29% | 97.47% |
| CHEMBL1871 | P10275 | Androgen Receptor | 84.00% | 96.43% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.36% | 100.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.31% | 93.40% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.41% | 99.18% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.39% | 90.24% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.30% | 95.89% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.16% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Actinidia polygama |
| PubChem | 11019224 |
| LOTUS | LTS0077886 |
| wikiData | Q105196637 |