(1S,4S,5R,8R,10S,13S,14R,17S,18R,20S)-10-[(2S,3S,4S,5S)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5,9,9,13,20-hexamethyl-2-oxo-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosane-20-carbaldehyde
Internal ID | 537e3473-4dc9-415a-851d-f262955f1f0b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1S,4S,5R,8R,10S,13S,14R,17S,18R,20S)-10-[(2S,3S,4S,5S)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5,9,9,13,20-hexamethyl-2-oxo-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosane-20-carbaldehyde |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3COC(C(C3O)OC4C(C(C(C(O4)CO)O)O)O)OC5CCC6(C(C5(C)C)CCC7(C6CCC89C7(CC(=O)C1(C8CC(CC1)(C)C=O)CO9)C)C)C)CO)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2O[C@H]3CO[C@H]([C@H]([C@H]3O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O[C@H]5CC[C@]6([C@H]7CC[C@@]89[C@@H]1C[C@@](CC[C@]1(CO8)C(=O)C[C@]9([C@@]7(CC[C@H]6C5(C)C)C)C)(C)C=O)C)CO)O)O)O)O)O |
InChI | InChI=1S/C53H84O22/c1-23-32(58)36(62)39(65)43(69-23)75-42-38(64)34(60)25(19-55)71-46(42)72-26-20-67-45(41(35(26)61)74-44-40(66)37(63)33(59)24(18-54)70-44)73-31-10-11-49(5)27(47(31,2)3)8-12-50(6)28(49)9-13-53-29-16-48(4,21-56)14-15-52(29,22-68-53)30(57)17-51(50,53)7/h21,23-29,31-46,54-55,58-66H,8-20,22H2,1-7H3/t23-,24+,25+,26-,27-,28+,29+,31-,32-,33+,34+,35-,36+,37-,38-,39+,40+,41-,42+,43-,44-,45-,46-,48-,49+,50+,51-,52+,53-/m0/s1 |
InChI Key | PBWPIOCXFOKCHR-LUDYUOLLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C53H84O22 |
Molecular Weight | 1073.20 g/mol |
Exact Mass | 1072.54542430 g/mol |
Topological Polar Surface Area (TPSA) | 340.00 Ų |
XlogP | -1.00 |
There are no found synonyms. |
![2D Structure of (1S,4S,5R,8R,10S,13S,14R,17S,18R,20S)-10-[(2S,3S,4S,5S)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5,9,9,13,20-hexamethyl-2-oxo-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosane-20-carbaldehyde 2D Structure of (1S,4S,5R,8R,10S,13S,14R,17S,18R,20S)-10-[(2S,3S,4S,5S)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4,5,9,9,13,20-hexamethyl-2-oxo-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracosane-20-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/5fae3b10-8227-11ee-8430-a931ef042828.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.05% | 91.11% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.81% | 94.75% |
CHEMBL2581 | P07339 | Cathepsin D | 92.29% | 98.95% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 91.42% | 92.97% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.55% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.44% | 86.33% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.95% | 97.36% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.68% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.54% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.11% | 99.23% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.63% | 96.61% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.25% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.95% | 89.00% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.96% | 97.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.86% | 94.00% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 84.67% | 83.57% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.32% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.00% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.12% | 99.17% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.50% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ardisia mamillata |
PubChem | 162995512 |
LOTUS | LTS0194475 |
wikiData | Q105205502 |