2-[5-Hydroxy-6-(hydroxymethyl)-2-(16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-19-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 160c7a38-68e1-451d-91b0-d23ce0977425 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[5-hydroxy-6-(hydroxymethyl)-2-(16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-19-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC(C6C5(CCC(C6)O)C)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)C)C)OC1 |
SMILES (Isomeric) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC(C6C5(CCC(C6)O)C)OC7C(C(C(C(O7)CO)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)CO)O)O)O)C)C)OC1 |
InChI | InChI=1S/C44H72O18/c1-18-5-10-44(56-16-18)19(2)30-27(62-44)13-23-21-12-26(24-11-20(47)6-8-42(24,3)22(21)7-9-43(23,30)4)57-41-38(61-40-36(54)34(52)32(50)28(14-45)58-40)37(33(51)29(15-46)59-41)60-39-35(53)31(49)25(48)17-55-39/h18-41,45-54H,5-17H2,1-4H3 |
InChI Key | IXBQBMHUAMIQDX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C44H72O18 |
Molecular Weight | 889.00 g/mol |
Exact Mass | 888.47186544 g/mol |
Topological Polar Surface Area (TPSA) | 276.00 Ų |
XlogP | 0.40 |
There are no found synonyms. |
![2D Structure of 2-[5-Hydroxy-6-(hydroxymethyl)-2-(16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-19-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol 2D Structure of 2-[5-Hydroxy-6-(hydroxymethyl)-2-(16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-19-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/5f091b40-856b-11ee-8331-6dd7c09f7958.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.42% | 96.09% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.23% | 96.61% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.76% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.02% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.51% | 95.93% |
CHEMBL233 | P35372 | Mu opioid receptor | 93.36% | 97.93% |
CHEMBL204 | P00734 | Thrombin | 92.40% | 96.01% |
CHEMBL237 | P41145 | Kappa opioid receptor | 91.72% | 98.10% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 91.44% | 95.58% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.69% | 95.50% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 89.97% | 97.86% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 89.51% | 92.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.48% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.29% | 100.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.36% | 96.77% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 87.63% | 92.88% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 87.02% | 97.28% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 86.70% | 92.78% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.19% | 96.95% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.86% | 96.21% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.75% | 92.86% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.61% | 95.89% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.37% | 100.00% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 84.29% | 95.38% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.11% | 91.24% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.75% | 95.89% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 82.70% | 96.67% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 82.15% | 97.31% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.91% | 97.25% |
CHEMBL249 | P25103 | Neurokinin 1 receptor | 81.85% | 99.17% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 81.05% | 89.05% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.90% | 92.94% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.50% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Camassia cusickii |
PubChem | 162960443 |
LOTUS | LTS0071017 |
wikiData | Q105122026 |